C13H19N3 — CID 116661348
3-[1-amino-2-(cyclohexen-1-yl)ethyl]pyridin-4-amine (PubChem CID 116661348) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is 3-[1-amino-2-(cyclohexen-1-yl)ethyl]pyridin-4-amine.
| Compound Name | 3-[1-amino-2-(cyclohexen-1-yl)ethyl]pyridin-4-amine |
|---|---|
| PubChem CID | 116661348 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 3-[1-amino-2-(cyclohexen-1-yl)ethyl]pyridin-4-amine |
| SMILES | Nc1ccncc1C(N)CC1=CCCCC1 |
| InChI | InChI=1S/C13H19N3/c14-12-6-7-16-9-11(12)13(15)8-10-4-2-1-3-5-10/h4,6-7,9,13H,1-3,5,8,15H2,(H2,14,16) |
| InChIKey | DYAFSNHMGNHMSL-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|