C23H34N6 — CID 143225799
4-[(3Z,6Z)-3-(aminomethyl)-7-(methylideneamino)hepta-1,3,6-trien-2-yl]-N-prop-2-enylpyrimidin-2-amine;(2E)-N,N-dimethylpenta-2,4-dien-2-amine (PubChem CID 143225799) has the molecular formula C23H34N6 and a molecular weight of 394.57 g/mol. Its IUPAC name is 4-[(3Z,6Z)-3-(aminomethyl)-7-(methylideneamino)hepta-1,3,6-trien-2-yl]-N-prop-2-enylpyrimidin-2-amine;(2E)-N,N-dimethylpenta-2,4-dien-2-amine.
| Compound Name | 4-[(3Z,6Z)-3-(aminomethyl)-7-(methylideneamino)hepta-1,3,6-trien-2-yl]-N-prop-2-enylpyrimidin-2-amine;(2E)-N,N-dimethylpenta-2,4-dien-2-amine |
|---|---|
| PubChem CID | 143225799 |
| Molecular Formula | C23H34N6 |
| Molecular Weight | 394.57 g/mol |
| Exact Mass | 394.28 |
| IUPAC Name | 4-[(3Z,6Z)-3-(aminomethyl)-7-(methylideneamino)hepta-1,3,6-trien-2-yl]-N-prop-2-enylpyrimidin-2-amine;(2E)-N,N-dimethylpenta-2,4-dien-2-amine |
| SMILES | C=C/C=C(\C)N(C)C.C=CCNc1nccc(C(=C)/C(=C/C/C=C\N=C)CN)n1 |
| InChI | InChI=1S/C16H21N5.C7H13N/c1-4-9-19-16-20-11-8-15(21-16)13(2)14(12-17)7-5-6-10-18-3;1-5-6-7(2)8(3)4/h4,6-8,10-11H,1-3,5,9,12,17H2,(H,19,20,21);5-6H,1H2,2-4H3/b10-6-,14-7+;7-6+ |
| InChIKey | WADLPZYYNONOHM-YBNNPKAJSA-N |
| XLogP | 4.22 |
| TPSA | 79.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.57 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|