C23H34N6 — CID 155424626
(2Z,4E,6Z)-2-[amino(methyl)amino]-1-N-[4-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]pyrimidin-2-yl]-4,7-dimethylnona-2,4,6-triene-1,3-diamine (PubChem CID 155424626) has the molecular formula C23H34N6 and a molecular weight of 394.57 g/mol. Its IUPAC name is (2Z,4E,6Z)-2-[amino(methyl)amino]-1-N-[4-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]pyrimidin-2-yl]-4,7-dimethylnona-2,4,6-triene-1,3-diamine.
| Compound Name | (2Z,4E,6Z)-2-[amino(methyl)amino]-1-N-[4-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]pyrimidin-2-yl]-4,7-dimethylnona-2,4,6-triene-1,3-diamine |
|---|---|
| PubChem CID | 155424626 |
| Molecular Formula | C23H34N6 |
| Molecular Weight | 394.57 g/mol |
| Exact Mass | 394.28 |
| IUPAC Name | (2Z,4E,6Z)-2-[amino(methyl)amino]-1-N-[4-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]pyrimidin-2-yl]-4,7-dimethylnona-2,4,6-triene-1,3-diamine |
| SMILES | C=C(/C=C\C=C/C)c1ccnc(NC/C(=C(N)\C(C)=C\C=C(\C)CC)N(C)N)n1 |
| InChI | InChI=1S/C23H34N6/c1-7-9-10-11-18(4)20-14-15-26-23(28-20)27-16-21(29(6)25)22(24)19(5)13-12-17(3)8-2/h7,9-15H,4,8,16,24-25H2,1-3,5-6H3,(H,26,27,28)/b9-7-,11-10-,17-12-,19-13+,22-21- |
| InChIKey | WXYDTAPAIMTHQV-CVFDAMNTSA-N |
| XLogP | 4.31 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.57 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|