C17H24 — CID 143829867
2-tert-butyl-3-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]cyclohexa-1,3-diene (PubChem CID 143829867) has the molecular formula C17H24 and a molecular weight of 228.38 g/mol. Its IUPAC name is 2-tert-butyl-3-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]cyclohexa-1,3-diene.
| Compound Name | 2-tert-butyl-3-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 143829867 |
| Molecular Formula | C17H24 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | 2-tert-butyl-3-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]cyclohexa-1,3-diene |
| SMILES | C=C(/C=C\C=C/C)C1=CCCC=C1C(C)(C)C |
| InChI | InChI=1S/C17H24/c1-6-7-8-11-14(2)15-12-9-10-13-16(15)17(3,4)5/h6-8,11-13H,2,9-10H2,1,3-5H3/b7-6-,11-8- |
| InChIKey | DOWHKKCXAFELPV-NJMVCRMVSA-N |
| XLogP | 5.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|