C19H22N2 — CID 142487989
ethane;2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-6-pyridin-2-ylpyridine (PubChem CID 142487989) has the molecular formula C19H22N2 and a molecular weight of 278.40 g/mol. Its IUPAC name is ethane;2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-6-pyridin-2-ylpyridine.
| Compound Name | ethane;2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-6-pyridin-2-ylpyridine |
|---|---|
| PubChem CID | 142487989 |
| Molecular Formula | C19H22N2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | ethane;2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-6-pyridin-2-ylpyridine |
| SMILES | C=C(/C=C\C=C/C)c1cccc(-c2ccccn2)n1.CC |
| InChI | InChI=1S/C17H16N2.C2H6/c1-3-4-5-9-14(2)15-11-8-12-17(19-15)16-10-6-7-13-18-16;1-2/h3-13H,2H2,1H3;1-2H3/b4-3-,9-5-; |
| InChIKey | OBAHWUGNUMRHDG-UPOARCEASA-N |
| XLogP | 5.32 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|