C14H10N2O — CID 135252428
1-(6-pyridin-2-yl-2-pyridinyl)but-2-yn-1-one (PubChem CID 135252428) has the molecular formula C14H10N2O and a molecular weight of 222.25 g/mol. Its IUPAC name is 1-(6-pyridin-2-yl-2-pyridinyl)but-2-yn-1-one.
| Compound Name | 1-(6-pyridin-2-yl-2-pyridinyl)but-2-yn-1-one |
|---|---|
| PubChem CID | 135252428 |
| Molecular Formula | C14H10N2O |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 1-(6-pyridin-2-yl-2-pyridinyl)but-2-yn-1-one |
| SMILES | CC#CC(=O)c1cccc(-c2ccccn2)n1 |
| InChI | InChI=1S/C14H10N2O/c1-2-6-14(17)13-9-5-8-12(16-13)11-7-3-4-10-15-11/h3-5,7-10H,1H3 |
| InChIKey | FAMDFRQFVRMBIZ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|