C19H16N2O3 — CID 135252418
(2,4-dimethoxyphenyl)-(6-pyridin-2-yl-2-pyridinyl)methanone (PubChem CID 135252418) has the molecular formula C19H16N2O3 and a molecular weight of 320.35 g/mol. Its IUPAC name is (2,4-dimethoxyphenyl)-(6-pyridin-2-yl-2-pyridinyl)methanone.
| Compound Name | (2,4-dimethoxyphenyl)-(6-pyridin-2-yl-2-pyridinyl)methanone |
|---|---|
| PubChem CID | 135252418 |
| Molecular Formula | C19H16N2O3 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | (2,4-dimethoxyphenyl)-(6-pyridin-2-yl-2-pyridinyl)methanone |
| SMILES | COc1ccc(C(=O)c2cccc(-c3ccccn3)n2)c(OC)c1 |
| InChI | InChI=1S/C19H16N2O3/c1-23-13-9-10-14(18(12-13)24-2)19(22)17-8-5-7-16(21-17)15-6-3-4-11-20-15/h3-12H,1-2H3 |
| InChIKey | INNPXTOQENNKKV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |