C12H9N2NaO3 — CID 71528602
sodium 4-methoxy-6-pyridin-2-ylpyridine-2-carboxylate (PubChem CID 71528602) has the molecular formula C12H9N2NaO3 and a molecular weight of 252.21 g/mol. Its IUPAC name is sodium 4-methoxy-6-pyridin-2-ylpyridine-2-carboxylate.
| Compound Name | sodium 4-methoxy-6-pyridin-2-ylpyridine-2-carboxylate |
|---|---|
| PubChem CID | 71528602 |
| Molecular Formula | C12H9N2NaO3 |
| Molecular Weight | 252.21 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | sodium 4-methoxy-6-pyridin-2-ylpyridine-2-carboxylate |
| SMILES | COc1cc(C(=O)[O-])nc(-c2ccccn2)c1.[Na+] |
| InChI | InChI=1S/C12H10N2O3.Na/c1-17-8-6-10(9-4-2-3-5-13-9)14-11(7-8)12(15)16;/h2-7H,1H3,(H,15,16);/q;+1/p-1 |
| InChIKey | LAWVJZXYKJQQLF-UHFFFAOYSA-M |
| XLogP | -2.48 |
| TPSA | 75.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.21 |
| LogP ≤ 5 | -2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |