About 4-(2-methoxyethoxy)-2,6-dipyridin-2-ylpyridine
4-(2-methoxyethoxy)-2,6-dipyridin-2-ylpyridine (PubChem CID 14879099) has the molecular formula C18H17N3O2
and a molecular weight of 307.35 g/mol. Its IUPAC name is 4-(2-methoxyethoxy)-2,6-dipyridin-2-ylpyridine.
Molecular Properties
| Compound Name | 4-(2-methoxyethoxy)-2,6-dipyridin-2-ylpyridine |
| PubChem CID | 14879099 |
| Molecular Formula | C18H17N3O2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 4-(2-methoxyethoxy)-2,6-dipyridin-2-ylpyridine |
| SMILES | COCCOc1cc(-c2ccccn2)nc(-c2ccccn2)c1 |
| InChI | InChI=1S/C18H17N3O2/c1-22-10-11-23-14-12-17(15-6-2-4-8-19-15)21-18(13-14)16-7-3-5-9-20-16/h2-9,12-13H,10-11H2,1H3 |
| InChIKey | KYNXGTUDZQGIOA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-methoxyethoxy)-2,6-dipyridin-2-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methoxyethoxy)-2,6-dipyridin-2-ylpyridine?
The IUPAC name of 4-(2-methoxyethoxy)-2,6-dipyridin-2-ylpyridine (CID 14879099) is 4-(2-methoxyethoxy)-2,6-dipyridin-2-ylpyridine.
What is the SMILES notation for 4-(2-methoxyethoxy)-2,6-dipyridin-2-ylpyridine?
The canonical SMILES for 4-(2-methoxyethoxy)-2,6-dipyridin-2-ylpyridine is COCCOc1cc(-c2ccccn2)nc(-c2ccccn2)c1.
What is the InChIKey of 4-(2-methoxyethoxy)-2,6-dipyridin-2-ylpyridine?
The InChIKey is KYNXGTUDZQGIOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N3O2/c1-22-10-11-23-14-12-17(15-6-2-4-8-19-15)21-18(13-14)16-7-3-5-9-20-16/h2-9,12-13H,10-11H2,1H3.
What are the key properties of 4-(2-methoxyethoxy)-2,6-dipyridin-2-ylpyridine?
4-(2-methoxyethoxy)-2,6-dipyridin-2-ylpyridine has a molecular weight of 307.35 g/mol, XLogP of 3.23, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methoxyethoxy)-2,6-dipyridin-2-ylpyridine is sourced from PubChem (CID 14879099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).