C33H37Br2N3O2 — CID 170271349
4-[3,5-bis(6-bromohexoxy)phenyl]-2,6-dipyridin-2-ylpyridine (PubChem CID 170271349) has the molecular formula C33H37Br2N3O2 and a molecular weight of 667.49 g/mol. Its IUPAC name is 4-[3,5-bis(6-bromohexoxy)phenyl]-2,6-dipyridin-2-ylpyridine.
| Compound Name | 4-[3,5-bis(6-bromohexoxy)phenyl]-2,6-dipyridin-2-ylpyridine |
|---|---|
| PubChem CID | 170271349 |
| Molecular Formula | C33H37Br2N3O2 |
| Molecular Weight | 667.49 g/mol |
| Exact Mass | 665.13 |
| IUPAC Name | 4-[3,5-bis(6-bromohexoxy)phenyl]-2,6-dipyridin-2-ylpyridine |
| SMILES | BrCCCCCCOc1cc(OCCCCCCBr)cc(-c2cc(-c3ccccn3)nc(-c3ccccn3)c2)c1 |
| InChI | InChI=1S/C33H37Br2N3O2/c34-15-7-1-3-11-19-39-28-21-26(22-29(25-28)40-20-12-4-2-8-16-35)27-23-32(30-13-5-9-17-36-30)38-33(24-27)31-14-6-10-18-37-31/h5-6,9-10,13-14,17-18,21-25H,1-4,7-8,11-12,15-16,19-20H2 |
| InChIKey | XOVMQESZAYWVHY-UHFFFAOYSA-N |
| XLogP | 9.54 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.49 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|