C43H52N4O2 — CID 132546422
N,N-bis(4-octoxyphenyl)-2,6-dipyridin-2-ylpyridin-4-amine (PubChem CID 132546422) has the molecular formula C43H52N4O2 and a molecular weight of 656.92 g/mol. Its IUPAC name is N,N-bis(4-octoxyphenyl)-2,6-dipyridin-2-ylpyridin-4-amine.
| Compound Name | N,N-bis(4-octoxyphenyl)-2,6-dipyridin-2-ylpyridin-4-amine |
|---|---|
| PubChem CID | 132546422 |
| Molecular Formula | C43H52N4O2 |
| Molecular Weight | 656.92 g/mol |
| Exact Mass | 656.41 |
| IUPAC Name | N,N-bis(4-octoxyphenyl)-2,6-dipyridin-2-ylpyridin-4-amine |
| SMILES | CCCCCCCCOc1ccc(N(c2ccc(OCCCCCCCC)cc2)c2cc(-c3ccccn3)nc(-c3ccccn3)c2)cc1 |
| InChI | InChI=1S/C43H52N4O2/c1-3-5-7-9-11-17-31-48-38-25-21-35(22-26-38)47(36-23-27-39(28-24-36)49-32-18-12-10-8-6-4-2)37-33-42(40-19-13-15-29-44-40)46-43(34-37)41-20-14-16-30-45-41/h13-16,19-30,33-34H,3-12,17-18,31-32H2,1-2H3 |
| InChIKey | FIBVOIRDRHZMNB-UHFFFAOYSA-N |
| XLogP | 12.15 |
| TPSA | 60.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.92 |
| LogP ≤ 5 | 12.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|