C34H30N6O — CID 162651464
4-[4-[4-(4-pentoxyphenyl)triazol-1-yl]phenyl]-2,6-dipyridin-2-ylpyridine (PubChem CID 162651464) has the molecular formula C34H30N6O and a molecular weight of 538.66 g/mol. Its IUPAC name is 4-[4-[4-(4-pentoxyphenyl)triazol-1-yl]phenyl]-2,6-dipyridin-2-ylpyridine.
| Compound Name | 4-[4-[4-(4-pentoxyphenyl)triazol-1-yl]phenyl]-2,6-dipyridin-2-ylpyridine |
|---|---|
| PubChem CID | 162651464 |
| Molecular Formula | C34H30N6O |
| Molecular Weight | 538.66 g/mol |
| Exact Mass | 538.25 |
| IUPAC Name | 4-[4-[4-(4-pentoxyphenyl)triazol-1-yl]phenyl]-2,6-dipyridin-2-ylpyridine |
| SMILES | CCCCCOc1ccc(-c2cn(-c3ccc(-c4cc(-c5ccccn5)nc(-c5ccccn5)c4)cc3)nn2)cc1 |
| InChI | InChI=1S/C34H30N6O/c1-2-3-8-21-41-29-17-13-26(14-18-29)34-24-40(39-38-34)28-15-11-25(12-16-28)27-22-32(30-9-4-6-19-35-30)37-33(23-27)31-10-5-7-20-36-31/h4-7,9-20,22-24H,2-3,8,21H2,1H3 |
| InChIKey | OKPALJAJOOTKSA-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 78.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.66 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|