C43H43N3O5 — CID 132610085
[4-[4-[1-(4-decoxyphenyl)triazol-4-yl]benzoyl]oxyphenyl] 4-cyclopenta-2,4-dien-1-ylbenzoate (PubChem CID 132610085) has the molecular formula C43H43N3O5 and a molecular weight of 681.83 g/mol. Its IUPAC name is [4-[4-[1-(4-decoxyphenyl)triazol-4-yl]benzoyl]oxyphenyl] 4-cyclopenta-2,4-dien-1-ylbenzoate.
| Compound Name | [4-[4-[1-(4-decoxyphenyl)triazol-4-yl]benzoyl]oxyphenyl] 4-cyclopenta-2,4-dien-1-ylbenzoate |
|---|---|
| PubChem CID | 132610085 |
| Molecular Formula | C43H43N3O5 |
| Molecular Weight | 681.83 g/mol |
| Exact Mass | 681.32 |
| IUPAC Name | [4-[4-[1-(4-decoxyphenyl)triazol-4-yl]benzoyl]oxyphenyl] 4-cyclopenta-2,4-dien-1-ylbenzoate |
| SMILES | CCCCCCCCCCOc1ccc(-n2cc(-c3ccc(C(=O)Oc4ccc(OC(=O)c5ccc(C6C=CC=C6)cc5)cc4)cc3)nn2)cc1 |
| InChI | InChI=1S/C43H43N3O5/c1-2-3-4-5-6-7-8-11-30-49-38-24-22-37(23-25-38)46-31-41(44-45-46)34-16-20-36(21-17-34)43(48)51-40-28-26-39(27-29-40)50-42(47)35-18-14-33(15-19-35)32-12-9-10-13-32/h9-10,12-29,31-32H,2-8,11,30H2,1H3 |
| InChIKey | YHOUXEXOSKVSSW-UHFFFAOYSA-N |
| XLogP | 10.10 |
| TPSA | 92.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.83 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|