C57H78N12O3 — CID 101498920
2,4,6-tris[1-(4-decoxyphenyl)triazol-4-yl]-1,3,5-triazine (PubChem CID 101498920) has the molecular formula C57H78N12O3 and a molecular weight of 979.33 g/mol. Its IUPAC name is 2,4,6-tris[1-(4-decoxyphenyl)triazol-4-yl]-1,3,5-triazine.
| Compound Name | 2,4,6-tris[1-(4-decoxyphenyl)triazol-4-yl]-1,3,5-triazine |
|---|---|
| PubChem CID | 101498920 |
| Molecular Formula | C57H78N12O3 |
| Molecular Weight | 979.33 g/mol |
| Exact Mass | 978.63 |
| IUPAC Name | 2,4,6-tris[1-(4-decoxyphenyl)triazol-4-yl]-1,3,5-triazine |
| SMILES | CCCCCCCCCCOc1ccc(-n2cc(-c3nc(-c4cn(-c5ccc(OCCCCCCCCCC)cc5)nn4)nc(-c4cn(-c5ccc(OCCCCCCCCCC)cc5)nn4)n3)nn2)cc1 |
| InChI | InChI=1S/C57H78N12O3/c1-4-7-10-13-16-19-22-25-40-70-49-34-28-46(29-35-49)67-43-52(61-64-67)55-58-56(53-44-68(65-62-53)47-30-36-50(37-31-47)71-41-26-23-20-17-14-11-8-5-2)60-57(59-55)54-45-69(66-63-54)48-32-38-51(39-33-48)72-42-27-24-21-18-15-12-9-6-3/h28-39,43-45H,4-27,40-42H2,1-3H3 |
| InChIKey | JQGNNEQUYBIFLE-UHFFFAOYSA-N |
| XLogP | 14.17 |
| TPSA | 158.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 979.33 |
| LogP ≤ 5 | 14.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|