C13H15N3O3 — CID 82201477
1-(4-butoxyphenyl)triazole-4-carboxylic acid (PubChem CID 82201477) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is 1-(4-butoxyphenyl)triazole-4-carboxylic acid.
| Compound Name | 1-(4-butoxyphenyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 82201477 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 1-(4-butoxyphenyl)triazole-4-carboxylic acid |
| SMILES | CCCCOc1ccc(-n2cc(C(=O)O)nn2)cc1 |
| InChI | InChI=1S/C13H15N3O3/c1-2-3-8-19-11-6-4-10(5-7-11)16-9-12(13(17)18)14-15-16/h4-7,9H,2-3,8H2,1H3,(H,17,18) |
| InChIKey | RBFSNPPMZHAFBR-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|