C16H22N4O3 — CID 130228631
2-[1-[4-[2-(diethylamino)ethoxy]phenyl]triazol-4-yl]acetic acid (PubChem CID 130228631) has the molecular formula C16H22N4O3 and a molecular weight of 318.38 g/mol. Its IUPAC name is 2-[1-[4-[2-(diethylamino)ethoxy]phenyl]triazol-4-yl]acetic acid.
| Compound Name | 2-[1-[4-[2-(diethylamino)ethoxy]phenyl]triazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 130228631 |
| Molecular Formula | C16H22N4O3 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 2-[1-[4-[2-(diethylamino)ethoxy]phenyl]triazol-4-yl]acetic acid |
| SMILES | CCN(CC)CCOc1ccc(-n2cc(CC(=O)O)nn2)cc1 |
| InChI | InChI=1S/C16H22N4O3/c1-3-19(4-2)9-10-23-15-7-5-14(6-8-15)20-12-13(17-18-20)11-16(21)22/h5-8,12H,3-4,9-11H2,1-2H3,(H,21,22) |
| InChIKey | FEJGLSZKFKXXKG-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |