C29H20N6 — CID 162662895
4-[4-(4-phenyltriazol-1-yl)phenyl]-2,6-dipyridin-2-ylpyridine (PubChem CID 162662895) has the molecular formula C29H20N6 and a molecular weight of 452.52 g/mol. Its IUPAC name is 4-[4-(4-phenyltriazol-1-yl)phenyl]-2,6-dipyridin-2-ylpyridine.
| Compound Name | 4-[4-(4-phenyltriazol-1-yl)phenyl]-2,6-dipyridin-2-ylpyridine |
|---|---|
| PubChem CID | 162662895 |
| Molecular Formula | C29H20N6 |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | 4-[4-(4-phenyltriazol-1-yl)phenyl]-2,6-dipyridin-2-ylpyridine |
| SMILES | c1ccc(-c2cn(-c3ccc(-c4cc(-c5ccccn5)nc(-c5ccccn5)c4)cc3)nn2)cc1 |
| InChI | InChI=1S/C29H20N6/c1-2-8-22(9-3-1)29-20-35(34-33-29)24-14-12-21(13-15-24)23-18-27(25-10-4-6-16-30-25)32-28(19-23)26-11-5-7-17-31-26/h1-20H |
| InChIKey | NNQFSJZJGDYCKO-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |