C37H23BrN6 — CID 102507811
4-[4-[1-(10-bromoanthracen-9-yl)triazol-4-yl]phenyl]-2,6-dipyridin-2-ylpyridine (PubChem CID 102507811) has the molecular formula C37H23BrN6 and a molecular weight of 631.54 g/mol. Its IUPAC name is 4-[4-[1-(10-bromoanthracen-9-yl)triazol-4-yl]phenyl]-2,6-dipyridin-2-ylpyridine.
| Compound Name | 4-[4-[1-(10-bromoanthracen-9-yl)triazol-4-yl]phenyl]-2,6-dipyridin-2-ylpyridine |
|---|---|
| PubChem CID | 102507811 |
| Molecular Formula | C37H23BrN6 |
| Molecular Weight | 631.54 g/mol |
| Exact Mass | 630.12 |
| IUPAC Name | 4-[4-[1-(10-bromoanthracen-9-yl)triazol-4-yl]phenyl]-2,6-dipyridin-2-ylpyridine |
| SMILES | Brc1c2ccccc2c(-n2cc(-c3ccc(-c4cc(-c5ccccn5)nc(-c5ccccn5)c4)cc3)nn2)c2ccccc12 |
| InChI | InChI=1S/C37H23BrN6/c38-36-27-9-1-3-11-29(27)37(30-12-4-2-10-28(30)36)44-23-35(42-43-44)25-17-15-24(16-18-25)26-21-33(31-13-5-7-19-39-31)41-34(22-26)32-14-6-8-20-40-32/h1-23H |
| InChIKey | XJDXQQRMIGMTPM-UHFFFAOYSA-N |
| XLogP | 9.19 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.54 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|