C18H29N — CID 143599197
ethane;2-ethylpyridine;(2Z,4Z)-6-methylideneocta-2,4-diene (PubChem CID 143599197) has the molecular formula C18H29N and a molecular weight of 259.44 g/mol. Its IUPAC name is ethane;2-ethylpyridine;(2Z,4Z)-6-methylideneocta-2,4-diene.
| Compound Name | ethane;2-ethylpyridine;(2Z,4Z)-6-methylideneocta-2,4-diene |
|---|---|
| PubChem CID | 143599197 |
| Molecular Formula | C18H29N |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | ethane;2-ethylpyridine;(2Z,4Z)-6-methylideneocta-2,4-diene |
| SMILES | C=C(/C=C\C=C/C)CC.CC.CCc1ccccn1 |
| InChI | InChI=1S/C9H14.C7H9N.C2H6/c1-4-6-7-8-9(3)5-2;1-2-7-5-3-4-6-8-7;1-2/h4,6-8H,3,5H2,1-2H3;3-6H,2H2,1H3;1-2H3/b6-4-,8-7-;; |
| InChIKey | QCYBXUIFHXRMQN-GTWMBCDHSA-N |
| XLogP | 5.76 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|