C13H16N2 — CID 89098917
(1Z,3Z)-5-methylidene-7-pyridin-2-ylhepta-1,3-dien-1-amine (PubChem CID 89098917) has the molecular formula C13H16N2 and a molecular weight of 200.28 g/mol. Its IUPAC name is (1Z,3Z)-5-methylidene-7-pyridin-2-ylhepta-1,3-dien-1-amine.
| Compound Name | (1Z,3Z)-5-methylidene-7-pyridin-2-ylhepta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 89098917 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | (1Z,3Z)-5-methylidene-7-pyridin-2-ylhepta-1,3-dien-1-amine |
| SMILES | C=C(/C=C\C=C/N)CCc1ccccn1 |
| InChI | InChI=1S/C13H16N2/c1-12(6-2-4-10-14)8-9-13-7-3-5-11-15-13/h2-7,10-11H,1,8-9,14H2/b6-2-,10-4- |
| InChIKey | VSELFJQRFUVMES-QPUPAZQPSA-N |
| XLogP | 2.60 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|