About 3-pyridin-2-ylpropanoyl chloride;hydrochloride
3-pyridin-2-ylpropanoyl chloride;hydrochloride (PubChem CID 87464337) has the molecular formula C8H9Cl2NO
and a molecular weight of 206.07 g/mol. Its IUPAC name is 3-pyridin-2-ylpropanoyl chloride;hydrochloride.
Molecular Properties
| Compound Name | 3-pyridin-2-ylpropanoyl chloride;hydrochloride |
| PubChem CID | 87464337 |
| Molecular Formula | C8H9Cl2NO |
| Molecular Weight | 206.07 g/mol |
| Exact Mass | 205.01 |
| IUPAC Name | 3-pyridin-2-ylpropanoyl chloride;hydrochloride |
| SMILES | Cl.O=C(Cl)CCc1ccccn1 |
| InChI | InChI=1S/C8H8ClNO.ClH/c9-8(11)5-4-7-3-1-2-6-10-7;/h1-3,6H,4-5H2;1H |
| InChIKey | OXUKIOVDJVFZRQ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.07 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-pyridin-2-ylpropanoyl chloride;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyridin-2-ylpropanoyl chloride;hydrochloride?
The IUPAC name of 3-pyridin-2-ylpropanoyl chloride;hydrochloride (CID 87464337) is 3-pyridin-2-ylpropanoyl chloride;hydrochloride.
What is the SMILES notation for 3-pyridin-2-ylpropanoyl chloride;hydrochloride?
The canonical SMILES for 3-pyridin-2-ylpropanoyl chloride;hydrochloride is Cl.O=C(Cl)CCc1ccccn1.
What is the InChIKey of 3-pyridin-2-ylpropanoyl chloride;hydrochloride?
The InChIKey is OXUKIOVDJVFZRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClNO.ClH/c9-8(11)5-4-7-3-1-2-6-10-7;/h1-3,6H,4-5H2;1H.
What are the key properties of 3-pyridin-2-ylpropanoyl chloride;hydrochloride?
3-pyridin-2-ylpropanoyl chloride;hydrochloride has a molecular weight of 206.07 g/mol, XLogP of 2.20, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyridin-2-ylpropanoyl chloride;hydrochloride is sourced from PubChem (CID 87464337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).