C18H23N — CID 126606807
2-[(2E,5Z,7Z)-4-methylidene-2-propylidenenona-5,7-dienyl]pyridine (PubChem CID 126606807) has the molecular formula C18H23N and a molecular weight of 253.39 g/mol. Its IUPAC name is 2-[(2E,5Z,7Z)-4-methylidene-2-propylidenenona-5,7-dienyl]pyridine.
| Compound Name | 2-[(2E,5Z,7Z)-4-methylidene-2-propylidenenona-5,7-dienyl]pyridine |
|---|---|
| PubChem CID | 126606807 |
| Molecular Formula | C18H23N |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 2-[(2E,5Z,7Z)-4-methylidene-2-propylidenenona-5,7-dienyl]pyridine |
| SMILES | C=C(/C=C\C=C/C)C/C(=C\CC)Cc1ccccn1 |
| InChI | InChI=1S/C18H23N/c1-4-6-7-11-16(3)14-17(10-5-2)15-18-12-8-9-13-19-18/h4,6-13H,3,5,14-15H2,1-2H3/b6-4-,11-7-,17-10+ |
| InChIKey | CTVSBYLGMXWZIE-APIASUFMSA-N |
| XLogP | 5.04 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|