C25H31N — CID 143823173
ethane;2-[[3-[(Z)-2-[(Z)-prop-1-enyl]pent-2-enyl]-1H-inden-1-yl]methyl]pyridine (PubChem CID 143823173) has the molecular formula C25H31N and a molecular weight of 345.53 g/mol. Its IUPAC name is ethane;2-[[3-[(Z)-2-[(Z)-prop-1-enyl]pent-2-enyl]-1H-inden-1-yl]methyl]pyridine.
| Compound Name | ethane;2-[[3-[(Z)-2-[(Z)-prop-1-enyl]pent-2-enyl]-1H-inden-1-yl]methyl]pyridine |
|---|---|
| PubChem CID | 143823173 |
| Molecular Formula | C25H31N |
| Molecular Weight | 345.53 g/mol |
| Exact Mass | 345.25 |
| IUPAC Name | ethane;2-[[3-[(Z)-2-[(Z)-prop-1-enyl]pent-2-enyl]-1H-inden-1-yl]methyl]pyridine |
| SMILES | C/C=C\C(=C/CC)CC1=CC(Cc2ccccn2)c2ccccc21.CC |
| InChI | InChI=1S/C23H25N.C2H6/c1-3-9-18(10-4-2)15-19-16-20(17-21-11-7-8-14-24-21)23-13-6-5-12-22(19)23;1-2/h3,5-14,16,20H,4,15,17H2,1-2H3;1-2H3/b9-3-,18-10+; |
| InChIKey | ISOCEHNJNUSHFR-FTUBABHMSA-N |
| XLogP | 7.13 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.53 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|