C27H34N6 — CID 169201494
N'-[(Z)-2-ethyliminopent-3-enyl]-N,N,N'-tris(pyridin-2-ylmethyl)ethane-1,2-diamine (PubChem CID 169201494) has the molecular formula C27H34N6 and a molecular weight of 442.61 g/mol. Its IUPAC name is N'-[(Z)-2-ethyliminopent-3-enyl]-N,N,N'-tris(pyridin-2-ylmethyl)ethane-1,2-diamine.
| Compound Name | N'-[(Z)-2-ethyliminopent-3-enyl]-N,N,N'-tris(pyridin-2-ylmethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 169201494 |
| Molecular Formula | C27H34N6 |
| Molecular Weight | 442.61 g/mol |
| Exact Mass | 442.28 |
| IUPAC Name | N'-[(Z)-2-ethyliminopent-3-enyl]-N,N,N'-tris(pyridin-2-ylmethyl)ethane-1,2-diamine |
| SMILES | C/C=C\C(CN(CCN(Cc1ccccn1)Cc1ccccn1)Cc1ccccn1)=N/CC |
| InChI | InChI=1S/C27H34N6/c1-3-11-24(28-4-2)20-32(21-25-12-5-8-15-29-25)18-19-33(22-26-13-6-9-16-30-26)23-27-14-7-10-17-31-27/h3,5-17H,4,18-23H2,1-2H3/b11-3-,28-24+ |
| InChIKey | DSUUUNJKTBKCDS-HSXZXRISSA-N |
| XLogP | 4.41 |
| TPSA | 57.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.61 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|