C9H14N2O — CID 20707216
[ethyl(pyridin-2-ylmethyl)amino]methanol (PubChem CID 20707216) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is [ethyl(pyridin-2-ylmethyl)amino]methanol.
| Compound Name | [ethyl(pyridin-2-ylmethyl)amino]methanol |
|---|---|
| PubChem CID | 20707216 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | [ethyl(pyridin-2-ylmethyl)amino]methanol |
| SMILES | CCN(CO)Cc1ccccn1 |
| InChI | InChI=1S/C9H14N2O/c1-2-11(8-12)7-9-5-3-4-6-10-9/h3-6,12H,2,7-8H2,1H3 |
| InChIKey | WETHJYJQUVOGCU-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|