C15H17BrN2 — CID 78942264
N-[(2-bromophenyl)methyl]-N-(pyridin-2-ylmethyl)ethanamine (PubChem CID 78942264) has the molecular formula C15H17BrN2 and a molecular weight of 305.22 g/mol. Its IUPAC name is N-[(2-bromophenyl)methyl]-N-(pyridin-2-ylmethyl)ethanamine.
| Compound Name | N-[(2-bromophenyl)methyl]-N-(pyridin-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 78942264 |
| Molecular Formula | C15H17BrN2 |
| Molecular Weight | 305.22 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | N-[(2-bromophenyl)methyl]-N-(pyridin-2-ylmethyl)ethanamine |
| SMILES | CCN(Cc1ccccn1)Cc1ccccc1Br |
| InChI | InChI=1S/C15H17BrN2/c1-2-18(12-14-8-5-6-10-17-14)11-13-7-3-4-9-15(13)16/h3-10H,2,11-12H2,1H3 |
| InChIKey | VSYQMCSZUVCXAX-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.22 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |