C19H26N4S — CID 102450567
3-[2-[bis(pyridin-2-ylmethyl)amino]ethylimino]-2-methylbutane-2-thiol (PubChem CID 102450567) has the molecular formula C19H26N4S and a molecular weight of 342.51 g/mol. Its IUPAC name is 3-[2-[bis(pyridin-2-ylmethyl)amino]ethylimino]-2-methylbutane-2-thiol.
| Compound Name | 3-[2-[bis(pyridin-2-ylmethyl)amino]ethylimino]-2-methylbutane-2-thiol |
|---|---|
| PubChem CID | 102450567 |
| Molecular Formula | C19H26N4S |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 3-[2-[bis(pyridin-2-ylmethyl)amino]ethylimino]-2-methylbutane-2-thiol |
| SMILES | C/C(=N\CCN(Cc1ccccn1)Cc1ccccn1)C(C)(C)S |
| InChI | InChI=1S/C19H26N4S/c1-16(19(2,3)24)20-12-13-23(14-17-8-4-6-10-21-17)15-18-9-5-7-11-22-18/h4-11,24H,12-15H2,1-3H3/b20-16+ |
| InChIKey | NVDVQJQLLWGIDG-CAPFRKAQSA-N |
| XLogP | 3.65 |
| TPSA | 41.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|