C14H21N — CID 145320713
ethane;2-[(2Z,4E)-hepta-2,4-dien-4-yl]pyridine (PubChem CID 145320713) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is ethane;2-[(2Z,4E)-hepta-2,4-dien-4-yl]pyridine.
| Compound Name | ethane;2-[(2Z,4E)-hepta-2,4-dien-4-yl]pyridine |
|---|---|
| PubChem CID | 145320713 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | ethane;2-[(2Z,4E)-hepta-2,4-dien-4-yl]pyridine |
| SMILES | C/C=C\C(=C/CC)c1ccccn1.CC |
| InChI | InChI=1S/C12H15N.C2H6/c1-3-7-11(8-4-2)12-9-5-6-10-13-12;1-2/h3,5-10H,4H2,1-2H3;1-2H3/b7-3-,11-8+; |
| InChIKey | CTKOYDCJAKYMGM-KJZVLMODSA-N |
| XLogP | 4.48 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|