C15H20N2 — CID 142517601
(3Z,5Z,7E)-3-methyl-7-pyridin-2-ylnona-3,5,7-trien-4-amine (PubChem CID 142517601) has the molecular formula C15H20N2 and a molecular weight of 228.34 g/mol. Its IUPAC name is (3Z,5Z,7E)-3-methyl-7-pyridin-2-ylnona-3,5,7-trien-4-amine.
| Compound Name | (3Z,5Z,7E)-3-methyl-7-pyridin-2-ylnona-3,5,7-trien-4-amine |
|---|---|
| PubChem CID | 142517601 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | (3Z,5Z,7E)-3-methyl-7-pyridin-2-ylnona-3,5,7-trien-4-amine |
| SMILES | C/C=C(/C=C\C(N)=C(/C)CC)c1ccccn1 |
| InChI | InChI=1S/C15H20N2/c1-4-12(3)14(16)10-9-13(5-2)15-8-6-7-11-17-15/h5-11H,4,16H2,1-3H3/b10-9-,13-5-,14-12- |
| InChIKey | OMNWQKXSJAQFEU-PZVKLRQYSA-N |
| XLogP | 3.68 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|