C20H30N2O — CID 142517482
N,N-dimethylcyclohexanamine;(3Z,5E)-5-pyridin-2-ylhepta-1,3,5-trien-2-ol (PubChem CID 142517482) has the molecular formula C20H30N2O and a molecular weight of 314.47 g/mol. Its IUPAC name is N,N-dimethylcyclohexanamine;(3Z,5E)-5-pyridin-2-ylhepta-1,3,5-trien-2-ol.
| Compound Name | N,N-dimethylcyclohexanamine;(3Z,5E)-5-pyridin-2-ylhepta-1,3,5-trien-2-ol |
|---|---|
| PubChem CID | 142517482 |
| Molecular Formula | C20H30N2O |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.24 |
| IUPAC Name | N,N-dimethylcyclohexanamine;(3Z,5E)-5-pyridin-2-ylhepta-1,3,5-trien-2-ol |
| SMILES | C=C(O)/C=C\C(=C/C)c1ccccn1.CN(C)C1CCCCC1 |
| InChI | InChI=1S/C12H13NO.C8H17N/c1-3-11(8-7-10(2)14)12-6-4-5-9-13-12;1-9(2)8-6-4-3-5-7-8/h3-9,14H,2H2,1H3;8H,3-7H2,1-2H3/b8-7-,11-3+; |
| InChIKey | MABZEUYOERZORN-AYMIGLINSA-N |
| XLogP | 4.99 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|