C13H22N2 — CID 122704912
N,N-dimethylcyclohexanamine;pyridine (PubChem CID 122704912) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is N,N-dimethylcyclohexanamine;pyridine.
| Compound Name | N,N-dimethylcyclohexanamine;pyridine |
|---|---|
| PubChem CID | 122704912 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | N,N-dimethylcyclohexanamine;pyridine |
| SMILES | CN(C)C1CCCCC1.c1ccncc1 |
| InChI | InChI=1S/C8H17N.C5H5N/c1-9(2)8-6-4-3-5-7-8;1-2-4-6-5-3-1/h8H,3-7H2,1-2H3;1-5H |
| InChIKey | XPXCPSSJSLHWOY-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |