C15H27N3 — CID 22238099
N,N-dimethylcyclohexanamine;N,N-dimethylpyridin-4-amine (PubChem CID 22238099) has the molecular formula C15H27N3 and a molecular weight of 249.40 g/mol. Its IUPAC name is N,N-dimethylcyclohexanamine;N,N-dimethylpyridin-4-amine.
| Compound Name | N,N-dimethylcyclohexanamine;N,N-dimethylpyridin-4-amine |
|---|---|
| PubChem CID | 22238099 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | N,N-dimethylcyclohexanamine;N,N-dimethylpyridin-4-amine |
| SMILES | CN(C)C1CCCCC1.CN(C)c1ccncc1 |
| InChI | InChI=1S/C8H17N.C7H10N2/c1-9(2)8-6-4-3-5-7-8;1-9(2)7-3-5-8-6-4-7/h8H,3-7H2,1-2H3;3-6H,1-2H3 |
| InChIKey | FNIPJVHVKUZNCA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |