C24H29N3O2 — CID 142517519
ethene;4-methoxy-N-[(E)-2-methyl-1-[(Z)-[(Z)-2-pyridin-2-ylbut-2-enylidene]amino]but-1-enyl]benzamide (PubChem CID 142517519) has the molecular formula C24H29N3O2 and a molecular weight of 391.52 g/mol. Its IUPAC name is ethene;4-methoxy-N-[(E)-2-methyl-1-[(Z)-[(Z)-2-pyridin-2-ylbut-2-enylidene]amino]but-1-enyl]benzamide.
| Compound Name | ethene;4-methoxy-N-[(E)-2-methyl-1-[(Z)-[(Z)-2-pyridin-2-ylbut-2-enylidene]amino]but-1-enyl]benzamide |
|---|---|
| PubChem CID | 142517519 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | ethene;4-methoxy-N-[(E)-2-methyl-1-[(Z)-[(Z)-2-pyridin-2-ylbut-2-enylidene]amino]but-1-enyl]benzamide |
| SMILES | C/C=C(\C=N/C(NC(=O)c1ccc(OC)cc1)=C(\C)CC)c1ccccn1.C=C |
| InChI | InChI=1S/C22H25N3O2.C2H4/c1-5-16(3)21(24-15-17(6-2)20-9-7-8-14-23-20)25-22(26)18-10-12-19(27-4)13-11-18;1-2/h6-15H,5H2,1-4H3,(H,25,26);1-2H2/b17-6+,21-16-,24-15-; |
| InChIKey | VTVUAYDLWIJNSO-GSIWVQHXSA-N |
| XLogP | 5.44 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|