C21H22ClN3O — CID 142517695
3-chloro-N-[(E)-2-methyl-1-[(Z)-[(Z)-2-pyridin-2-ylbut-2-enylidene]amino]but-1-enyl]benzamide (PubChem CID 142517695) has the molecular formula C21H22ClN3O and a molecular weight of 367.88 g/mol. Its IUPAC name is 3-chloro-N-[(E)-2-methyl-1-[(Z)-[(Z)-2-pyridin-2-ylbut-2-enylidene]amino]but-1-enyl]benzamide.
| Compound Name | 3-chloro-N-[(E)-2-methyl-1-[(Z)-[(Z)-2-pyridin-2-ylbut-2-enylidene]amino]but-1-enyl]benzamide |
|---|---|
| PubChem CID | 142517695 |
| Molecular Formula | C21H22ClN3O |
| Molecular Weight | 367.88 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 3-chloro-N-[(E)-2-methyl-1-[(Z)-[(Z)-2-pyridin-2-ylbut-2-enylidene]amino]but-1-enyl]benzamide |
| SMILES | C/C=C(\C=N/C(NC(=O)c1cccc(Cl)c1)=C(\C)CC)c1ccccn1 |
| InChI | InChI=1S/C21H22ClN3O/c1-4-15(3)20(25-21(26)17-9-8-10-18(22)13-17)24-14-16(5-2)19-11-6-7-12-23-19/h5-14H,4H2,1-3H3,(H,25,26)/b16-5+,20-15-,24-14- |
| InChIKey | WFVXJLFRIIBODX-GHMRPNOXSA-N |
| XLogP | 5.28 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.88 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|