C14H19N — CID 145149493
ethane;2-[(2Z)-2-ethenylpenta-2,4-dienyl]pyridine (PubChem CID 145149493) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is ethane;2-[(2Z)-2-ethenylpenta-2,4-dienyl]pyridine.
| Compound Name | ethane;2-[(2Z)-2-ethenylpenta-2,4-dienyl]pyridine |
|---|---|
| PubChem CID | 145149493 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | ethane;2-[(2Z)-2-ethenylpenta-2,4-dienyl]pyridine |
| SMILES | C=C/C=C(\C=C)Cc1ccccn1.CC |
| InChI | InChI=1S/C12H13N.C2H6/c1-3-7-11(4-2)10-12-8-5-6-9-13-12;1-2/h3-9H,1-2,10H2;1-2H3/b11-7+; |
| InChIKey | LKJBIWGLIGJTQC-RVDQCCQOSA-N |
| XLogP | 3.95 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|