C20H23N3 — CID 142289230
(2E,4Z)-2-methyl-N,N-bis(pyridin-2-ylmethyl)hepta-2,4,6-trien-1-amine (PubChem CID 142289230) has the molecular formula C20H23N3 and a molecular weight of 305.43 g/mol. Its IUPAC name is (2E,4Z)-2-methyl-N,N-bis(pyridin-2-ylmethyl)hepta-2,4,6-trien-1-amine.
| Compound Name | (2E,4Z)-2-methyl-N,N-bis(pyridin-2-ylmethyl)hepta-2,4,6-trien-1-amine |
|---|---|
| PubChem CID | 142289230 |
| Molecular Formula | C20H23N3 |
| Molecular Weight | 305.43 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | (2E,4Z)-2-methyl-N,N-bis(pyridin-2-ylmethyl)hepta-2,4,6-trien-1-amine |
| SMILES | C=C/C=C\C=C(/C)CN(Cc1ccccn1)Cc1ccccn1 |
| InChI | InChI=1S/C20H23N3/c1-3-4-5-10-18(2)15-23(16-19-11-6-8-13-21-19)17-20-12-7-9-14-22-20/h3-14H,1,15-17H2,2H3/b5-4-,18-10+ |
| InChIKey | KLFBUKJUPPGXNJ-SSAWSCCNSA-N |
| XLogP | 4.17 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.43 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|