C18H24N2O2 — CID 142301368
ethyl 2-[[(2E,4Z)-2-methylhepta-2,4,6-trienyl]-(pyridin-2-ylmethyl)amino]acetate (PubChem CID 142301368) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is ethyl 2-[[(2E,4Z)-2-methylhepta-2,4,6-trienyl]-(pyridin-2-ylmethyl)amino]acetate.
| Compound Name | ethyl 2-[[(2E,4Z)-2-methylhepta-2,4,6-trienyl]-(pyridin-2-ylmethyl)amino]acetate |
|---|---|
| PubChem CID | 142301368 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | ethyl 2-[[(2E,4Z)-2-methylhepta-2,4,6-trienyl]-(pyridin-2-ylmethyl)amino]acetate |
| SMILES | C=C/C=C\C=C(/C)CN(CC(=O)OCC)Cc1ccccn1 |
| InChI | InChI=1S/C18H24N2O2/c1-4-6-7-10-16(3)13-20(15-18(21)22-5-2)14-17-11-8-9-12-19-17/h4,6-12H,1,5,13-15H2,2-3H3/b7-6-,16-10+ |
| InChIKey | SXJSYTSXLVRSMQ-XVRBRGRQSA-N |
| XLogP | 3.14 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|