C31H44N4 — CID 172578940
N-(1,2-dihydropyridin-2-ylmethyl)-N-[(E,2E)-2-ethylidenehept-3-enyl]-N'-[(2E,4Z)-2-methylhepta-2,4,6-trienyl]-N'-(pyridin-2-ylmethyl)ethane-1,2-diamine (PubChem CID 172578940) has the molecular formula C31H44N4 and a molecular weight of 472.72 g/mol. Its IUPAC name is N-(1,2-dihydropyridin-2-ylmethyl)-N-[(E,2E)-2-ethylidenehept-3-enyl]-N'-[(2E,4Z)-2-methylhepta-2,4,6-trienyl]-N'-(pyridin-2-ylmethyl)ethane-1,2-diamine.
| Compound Name | N-(1,2-dihydropyridin-2-ylmethyl)-N-[(E,2E)-2-ethylidenehept-3-enyl]-N'-[(2E,4Z)-2-methylhepta-2,4,6-trienyl]-N'-(pyridin-2-ylmethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 172578940 |
| Molecular Formula | C31H44N4 |
| Molecular Weight | 472.72 g/mol |
| Exact Mass | 472.36 |
| IUPAC Name | N-(1,2-dihydropyridin-2-ylmethyl)-N-[(E,2E)-2-ethylidenehept-3-enyl]-N'-[(2E,4Z)-2-methylhepta-2,4,6-trienyl]-N'-(pyridin-2-ylmethyl)ethane-1,2-diamine |
| SMILES | C=C/C=C\C=C(/C)CN(CCN(CC(/C=C/CCC)=C/C)CC1C=CC=CN1)Cc1ccccn1 |
| InChI | InChI=1S/C31H44N4/c1-5-8-10-16-28(4)24-34(26-30-18-12-14-20-32-30)22-23-35(27-31-19-13-15-21-33-31)25-29(7-3)17-11-9-6-2/h5,7-8,10-21,31,33H,1,6,9,22-27H2,2-4H3/b10-8-,17-11+,28-16+,29-7+ |
| InChIKey | HEBWCYNQMNSAGZ-SMNUAVRXSA-N |
| XLogP | 6.22 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.72 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|