C21H26N2 — CID 172578813
ethane;2-[(3Z,5E)-6-methyl-2-methylidene-7-pyridin-2-ylhepta-3,5-dienyl]pyridine (PubChem CID 172578813) has the molecular formula C21H26N2 and a molecular weight of 306.45 g/mol. Its IUPAC name is ethane;2-[(3Z,5E)-6-methyl-2-methylidene-7-pyridin-2-ylhepta-3,5-dienyl]pyridine.
| Compound Name | ethane;2-[(3Z,5E)-6-methyl-2-methylidene-7-pyridin-2-ylhepta-3,5-dienyl]pyridine |
|---|---|
| PubChem CID | 172578813 |
| Molecular Formula | C21H26N2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | ethane;2-[(3Z,5E)-6-methyl-2-methylidene-7-pyridin-2-ylhepta-3,5-dienyl]pyridine |
| SMILES | C=C(/C=C\C=C(/C)Cc1ccccn1)Cc1ccccn1.CC |
| InChI | InChI=1S/C19H20N2.C2H6/c1-16(14-18-10-3-5-12-20-18)8-7-9-17(2)15-19-11-4-6-13-21-19;1-2/h3-13H,1,14-15H2,2H3;1-2H3/b8-7-,17-9+; |
| InChIKey | LKJGCPONVZUFBL-UFCHAAFQSA-N |
| XLogP | 5.35 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|