C14H17NS — CID 144892259
2-[[(3Z,5Z)-2-methylidenehepta-3,5-dienyl]sulfanylmethyl]pyridine (PubChem CID 144892259) has the molecular formula C14H17NS and a molecular weight of 231.36 g/mol. Its IUPAC name is 2-[[(3Z,5Z)-2-methylidenehepta-3,5-dienyl]sulfanylmethyl]pyridine.
| Compound Name | 2-[[(3Z,5Z)-2-methylidenehepta-3,5-dienyl]sulfanylmethyl]pyridine |
|---|---|
| PubChem CID | 144892259 |
| Molecular Formula | C14H17NS |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 2-[[(3Z,5Z)-2-methylidenehepta-3,5-dienyl]sulfanylmethyl]pyridine |
| SMILES | C=C(/C=C\C=C/C)CSCc1ccccn1 |
| InChI | InChI=1S/C14H17NS/c1-3-4-5-8-13(2)11-16-12-14-9-6-7-10-15-14/h3-10H,2,11-12H2,1H3/b4-3-,8-5- |
| InChIKey | SFXSXXGQDGTOSG-UBNNFMAXSA-N |
| XLogP | 4.00 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|