C11H16N2O2S — CID 110901648
N-(2-hydroxypropyl)-2-(pyridin-2-ylmethylsulfanyl)acetamide (PubChem CID 110901648) has the molecular formula C11H16N2O2S and a molecular weight of 240.33 g/mol. Its IUPAC name is N-(2-hydroxypropyl)-2-(pyridin-2-ylmethylsulfanyl)acetamide.
| Compound Name | N-(2-hydroxypropyl)-2-(pyridin-2-ylmethylsulfanyl)acetamide |
|---|---|
| PubChem CID | 110901648 |
| Molecular Formula | C11H16N2O2S |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | N-(2-hydroxypropyl)-2-(pyridin-2-ylmethylsulfanyl)acetamide |
| SMILES | CC(O)CNC(=O)CSCc1ccccn1 |
| InChI | InChI=1S/C11H16N2O2S/c1-9(14)6-13-11(15)8-16-7-10-4-2-3-5-12-10/h2-5,9,14H,6-8H2,1H3,(H,13,15) |
| InChIKey | SLHVJENGCXVURR-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |