C12H19N3OS — CID 120827351
N-[2-(methylamino)propyl]-2-(pyridin-2-ylmethylsulfanyl)acetamide (PubChem CID 120827351) has the molecular formula C12H19N3OS and a molecular weight of 253.37 g/mol. Its IUPAC name is N-[2-(methylamino)propyl]-2-(pyridin-2-ylmethylsulfanyl)acetamide.
| Compound Name | N-[2-(methylamino)propyl]-2-(pyridin-2-ylmethylsulfanyl)acetamide |
|---|---|
| PubChem CID | 120827351 |
| Molecular Formula | C12H19N3OS |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | N-[2-(methylamino)propyl]-2-(pyridin-2-ylmethylsulfanyl)acetamide |
| SMILES | CNC(C)CNC(=O)CSCc1ccccn1 |
| InChI | InChI=1S/C12H19N3OS/c1-10(13-2)7-15-12(16)9-17-8-11-5-3-4-6-14-11/h3-6,10,13H,7-9H2,1-2H3,(H,15,16) |
| InChIKey | MSIBKAYVRZKCKR-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |