C13H23Cl2N3OS — CID 120831636
N-[2-(methylamino)propyl]-3-(pyridin-2-ylmethylsulfanyl)propanamide;dihydrochloride (PubChem CID 120831636) has the molecular formula C13H23Cl2N3OS and a molecular weight of 340.32 g/mol. Its IUPAC name is N-[2-(methylamino)propyl]-3-(pyridin-2-ylmethylsulfanyl)propanamide;dihydrochloride.
| Compound Name | N-[2-(methylamino)propyl]-3-(pyridin-2-ylmethylsulfanyl)propanamide;dihydrochloride |
|---|---|
| PubChem CID | 120831636 |
| Molecular Formula | C13H23Cl2N3OS |
| Molecular Weight | 340.32 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | N-[2-(methylamino)propyl]-3-(pyridin-2-ylmethylsulfanyl)propanamide;dihydrochloride |
| SMILES | CNC(C)CNC(=O)CCSCc1ccccn1.Cl.Cl |
| InChI | InChI=1S/C13H21N3OS.2ClH/c1-11(14-2)9-16-13(17)6-8-18-10-12-5-3-4-7-15-12;;/h3-5,7,11,14H,6,8-10H2,1-2H3,(H,16,17);2*1H |
| InChIKey | DAMUJBQVSOABRP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.32 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|