C12H21Cl2N3OS — CID 119503687
N-[2-(methylamino)ethyl]-3-(pyridin-2-ylmethylsulfanyl)propanamide;dihydrochloride (PubChem CID 119503687) has the molecular formula C12H21Cl2N3OS and a molecular weight of 326.29 g/mol. Its IUPAC name is N-[2-(methylamino)ethyl]-3-(pyridin-2-ylmethylsulfanyl)propanamide;dihydrochloride.
| Compound Name | N-[2-(methylamino)ethyl]-3-(pyridin-2-ylmethylsulfanyl)propanamide;dihydrochloride |
|---|---|
| PubChem CID | 119503687 |
| Molecular Formula | C12H21Cl2N3OS |
| Molecular Weight | 326.29 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | N-[2-(methylamino)ethyl]-3-(pyridin-2-ylmethylsulfanyl)propanamide;dihydrochloride |
| SMILES | CNCCNC(=O)CCSCc1ccccn1.Cl.Cl |
| InChI | InChI=1S/C12H19N3OS.2ClH/c1-13-7-8-15-12(16)5-9-17-10-11-4-2-3-6-14-11;;/h2-4,6,13H,5,7-10H2,1H3,(H,15,16);2*1H |
| InChIKey | PKFAYEOEOZRIMM-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.29 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|