C17H29Cl2N3OS — CID 119591648
N-(2-amino-1-cyclohexylethyl)-3-(pyridin-2-ylmethylsulfanyl)propanamide;dihydrochloride (PubChem CID 119591648) has the molecular formula C17H29Cl2N3OS and a molecular weight of 394.41 g/mol. Its IUPAC name is N-(2-amino-1-cyclohexylethyl)-3-(pyridin-2-ylmethylsulfanyl)propanamide;dihydrochloride.
| Compound Name | N-(2-amino-1-cyclohexylethyl)-3-(pyridin-2-ylmethylsulfanyl)propanamide;dihydrochloride |
|---|---|
| PubChem CID | 119591648 |
| Molecular Formula | C17H29Cl2N3OS |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | N-(2-amino-1-cyclohexylethyl)-3-(pyridin-2-ylmethylsulfanyl)propanamide;dihydrochloride |
| SMILES | Cl.Cl.NCC(NC(=O)CCSCc1ccccn1)C1CCCCC1 |
| InChI | InChI=1S/C17H27N3OS.2ClH/c18-12-16(14-6-2-1-3-7-14)20-17(21)9-11-22-13-15-8-4-5-10-19-15;;/h4-5,8,10,14,16H,1-3,6-7,9,11-13,18H2,(H,20,21);2*1H |
| InChIKey | UNIGBLXTIDMZIO-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|