C17H27N3OS — CID 119591649
N-(2-amino-1-cyclohexylethyl)-3-(pyridin-2-ylmethylsulfanyl)propanamide (PubChem CID 119591649) has the molecular formula C17H27N3OS and a molecular weight of 321.49 g/mol. Its IUPAC name is N-(2-amino-1-cyclohexylethyl)-3-(pyridin-2-ylmethylsulfanyl)propanamide.
| Compound Name | N-(2-amino-1-cyclohexylethyl)-3-(pyridin-2-ylmethylsulfanyl)propanamide |
|---|---|
| PubChem CID | 119591649 |
| Molecular Formula | C17H27N3OS |
| Molecular Weight | 321.49 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | N-(2-amino-1-cyclohexylethyl)-3-(pyridin-2-ylmethylsulfanyl)propanamide |
| SMILES | NCC(NC(=O)CCSCc1ccccn1)C1CCCCC1 |
| InChI | InChI=1S/C17H27N3OS/c18-12-16(14-6-2-1-3-7-14)20-17(21)9-11-22-13-15-8-4-5-10-19-15/h4-5,8,10,14,16H,1-3,6-7,9,11-13,18H2,(H,20,21) |
| InChIKey | AOKCPVDEUOEUDB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.49 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|