C17H18F2N2OS — CID 94817882
N-[(1S)-1-(3,4-difluorophenyl)ethyl]-3-(pyridin-2-ylmethylsulfanyl)propanamide (PubChem CID 94817882) has the molecular formula C17H18F2N2OS and a molecular weight of 336.41 g/mol. Its IUPAC name is N-[(1S)-1-(3,4-difluorophenyl)ethyl]-3-(pyridin-2-ylmethylsulfanyl)propanamide.
| Compound Name | N-[(1S)-1-(3,4-difluorophenyl)ethyl]-3-(pyridin-2-ylmethylsulfanyl)propanamide |
|---|---|
| PubChem CID | 94817882 |
| Molecular Formula | C17H18F2N2OS |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | N-[(1S)-1-(3,4-difluorophenyl)ethyl]-3-(pyridin-2-ylmethylsulfanyl)propanamide |
| SMILES | C[C@H](NC(=O)CCSCc1ccccn1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H18F2N2OS/c1-12(13-5-6-15(18)16(19)10-13)21-17(22)7-9-23-11-14-4-2-3-8-20-14/h2-6,8,10,12H,7,9,11H2,1H3,(H,21,22)/t12-/m0/s1 |
| InChIKey | RPLYNPPPPIHKID-LBPRGKRZSA-N |
| XLogP | 3.86 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|