C17H17F3N2O2S — CID 55825302
2-(pyridin-2-ylmethylsulfanyl)-N-[1-[4-(trifluoromethoxy)phenyl]ethyl]acetamide (PubChem CID 55825302) has the molecular formula C17H17F3N2O2S and a molecular weight of 370.40 g/mol. Its IUPAC name is 2-(pyridin-2-ylmethylsulfanyl)-N-[1-[4-(trifluoromethoxy)phenyl]ethyl]acetamide.
| Compound Name | 2-(pyridin-2-ylmethylsulfanyl)-N-[1-[4-(trifluoromethoxy)phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 55825302 |
| Molecular Formula | C17H17F3N2O2S |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 2-(pyridin-2-ylmethylsulfanyl)-N-[1-[4-(trifluoromethoxy)phenyl]ethyl]acetamide |
| SMILES | CC(NC(=O)CSCc1ccccn1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H17F3N2O2S/c1-12(13-5-7-15(8-6-13)24-17(18,19)20)22-16(23)11-25-10-14-4-2-3-9-21-14/h2-9,12H,10-11H2,1H3,(H,22,23) |
| InChIKey | GPOUDOKIODZYET-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |