C18H22N4O2S — CID 120604457
N-(2-aminoethyl)-2-[3-(pyridin-2-ylmethylsulfanyl)propanoylamino]benzamide (PubChem CID 120604457) has the molecular formula C18H22N4O2S and a molecular weight of 358.47 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-[3-(pyridin-2-ylmethylsulfanyl)propanoylamino]benzamide.
| Compound Name | N-(2-aminoethyl)-2-[3-(pyridin-2-ylmethylsulfanyl)propanoylamino]benzamide |
|---|---|
| PubChem CID | 120604457 |
| Molecular Formula | C18H22N4O2S |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | N-(2-aminoethyl)-2-[3-(pyridin-2-ylmethylsulfanyl)propanoylamino]benzamide |
| SMILES | NCCNC(=O)c1ccccc1NC(=O)CCSCc1ccccn1 |
| InChI | InChI=1S/C18H22N4O2S/c19-9-11-21-18(24)15-6-1-2-7-16(15)22-17(23)8-12-25-13-14-5-3-4-10-20-14/h1-7,10H,8-9,11-13,19H2,(H,21,24)(H,22,23) |
| InChIKey | IZZSIZBBJOBYPJ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|