C21H26ClN3O2S — CID 55825162
N-[2-(2-chlorophenyl)-2-morpholin-4-ylethyl]-3-(pyridin-2-ylmethylsulfanyl)propanamide (PubChem CID 55825162) has the molecular formula C21H26ClN3O2S and a molecular weight of 419.98 g/mol. Its IUPAC name is N-[2-(2-chlorophenyl)-2-morpholin-4-ylethyl]-3-(pyridin-2-ylmethylsulfanyl)propanamide.
| Compound Name | N-[2-(2-chlorophenyl)-2-morpholin-4-ylethyl]-3-(pyridin-2-ylmethylsulfanyl)propanamide |
|---|---|
| PubChem CID | 55825162 |
| Molecular Formula | C21H26ClN3O2S |
| Molecular Weight | 419.98 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | N-[2-(2-chlorophenyl)-2-morpholin-4-ylethyl]-3-(pyridin-2-ylmethylsulfanyl)propanamide |
| SMILES | O=C(CCSCc1ccccn1)NCC(c1ccccc1Cl)N1CCOCC1 |
| InChI | InChI=1S/C21H26ClN3O2S/c22-19-7-2-1-6-18(19)20(25-10-12-27-13-11-25)15-24-21(26)8-14-28-16-17-5-3-4-9-23-17/h1-7,9,20H,8,10-16H2,(H,24,26) |
| InChIKey | QBGOUJHSCHUDAW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.98 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|